C15H24Cl2N4O2 — CID 119834602
N-[3-(benzimidazol-1-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride (PubChem CID 119834602) has the molecular formula C15H24Cl2N4O2 and a molecular weight of 363.29 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119834602 |
| Molecular Formula | C15H24Cl2N4O2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NCCCn1cnc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C15H22N4O2.2ClH/c1-21-10-8-16-11-15(20)17-7-4-9-19-12-18-13-5-2-3-6-14(13)19;;/h2-3,5-6,12,16H,4,7-11H2,1H3,(H,17,20);2*1H |
| InChIKey | NXNOFLQAKBGHNF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|