C12H11Cl2NO4 — CID 7843867
2-oxopropyl 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 7843867) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-oxopropyl 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | 2-oxopropyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7843867 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-oxopropyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | CC(=O)COC(=O)CNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2NO4/c1-7(16)6-19-11(17)5-15-12(18)9-3-2-8(13)4-10(9)14/h2-4H,5-6H2,1H3,(H,15,18) |
| InChIKey | AQVWOHSWASVZER-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |