C23H24O6 — CID 4574769
butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate (PubChem CID 4574769) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate.
| Compound Name | butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 4574769 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate |
| SMILES | CCc1ccc(Oc2coc3cc(OCC(=O)OC(C)CC)ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H24O6/c1-4-15(3)28-22(24)14-26-18-10-11-19-20(12-18)27-13-21(23(19)25)29-17-8-6-16(5-2)7-9-17/h6-13,15H,4-5,14H2,1-3H3 |
| InChIKey | CYOMZJASBKDVDA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |