butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate

C23H24O6 — CID 4574769

IUPACbutan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate
SMILESCCc1ccc(Oc2coc3cc(OCC(=O)OC(C)CC)ccc3c2=O)cc1
InChIInChI=1S/C23H24O6/c1-4-15(3)28-22(24)14-26-18-10-11-19-20(12-18)27-13-21(23(19)25)29-17-8-6-16(5-2)7-9-17/h6-13,15H,4-5,14H2,1-3H3
InChIKeyCYOMZJASBKDVDA-UHFFFAOYSA-N
MW396.44 g/mol
LogP4.87
Rot. Bonds8

About butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate

butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate (PubChem CID 4574769) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate.

Molecular Properties

Compound Namebutan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate
PubChem CID4574769
Molecular FormulaC23H24O6
Molecular Weight396.44 g/mol
Exact Mass396.16
IUPAC Namebutan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate
SMILESCCc1ccc(Oc2coc3cc(OCC(=O)OC(C)CC)ccc3c2=O)cc1
InChIInChI=1S/C23H24O6/c1-4-15(3)28-22(24)14-26-18-10-11-19-20(12-18)27-13-21(23(19)25)29-17-8-6-16(5-2)7-9-17/h6-13,15H,4-5,14H2,1-3H3
InChIKeyCYOMZJASBKDVDA-UHFFFAOYSA-N
XLogP4.87
TPSA74.97 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500396.44
LogP ≤ 54.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate?
The IUPAC name of butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate (CID 4574769) is butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate.
What is the SMILES notation for butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate?
The canonical SMILES for butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate is CCc1ccc(Oc2coc3cc(OCC(=O)OC(C)CC)ccc3c2=O)cc1.
What is the InChIKey of butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate?
The InChIKey is CYOMZJASBKDVDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O6/c1-4-15(3)28-22(24)14-26-18-10-11-19-20(12-18)27-13-21(23(19)25)29-17-8-6-16(5-2)7-9-17/h6-13,15H,4-5,14H2,1-3H3.
What are the key properties of butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate?
butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate has a molecular weight of 396.44 g/mol, XLogP of 4.87, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxyacetate is sourced from PubChem (CID 4574769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).