C23H24O6 — CID 22687629
3-[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxypropanoic acid (PubChem CID 22687629) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxypropanoic acid.
| Compound Name | 3-[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 22687629 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxypropanoic acid |
| SMILES | CCC(C)(C)c1ccc(Oc2coc3cc(OCCC(=O)O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H24O6/c1-4-23(2,3)15-5-7-16(8-6-15)29-20-14-28-19-13-17(27-12-11-21(24)25)9-10-18(19)22(20)26/h5-10,13-14H,4,11-12H2,1-3H3,(H,24,25) |
| InChIKey | MLOFUUFJMBSPAF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |