C22H22O6 — CID 20992382
4-[4-oxo-3-(2,3,5-trimethylphenoxy)chromen-7-yl]oxybutanoic acid (PubChem CID 20992382) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-[4-oxo-3-(2,3,5-trimethylphenoxy)chromen-7-yl]oxybutanoic acid.
| Compound Name | 4-[4-oxo-3-(2,3,5-trimethylphenoxy)chromen-7-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 20992382 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[4-oxo-3-(2,3,5-trimethylphenoxy)chromen-7-yl]oxybutanoic acid |
| SMILES | Cc1cc(C)c(C)c(Oc2coc3cc(OCCCC(=O)O)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H22O6/c1-13-9-14(2)15(3)18(10-13)28-20-12-27-19-11-16(6-7-17(19)22(20)25)26-8-4-5-21(23)24/h6-7,9-12H,4-5,8H2,1-3H3,(H,23,24) |
| InChIKey | FRZDLBSVBPOYDZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|