C21H20O6 — CID 20990110
4-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid (PubChem CID 20990110) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid.
| Compound Name | 4-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 20990110 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid |
| SMILES | Cc1cc(C)cc(Oc2coc3cc(OCCCC(=O)O)ccc3c2=O)c1 |
| InChI | InChI=1S/C21H20O6/c1-13-8-14(2)10-16(9-13)27-19-12-26-18-11-15(5-6-17(18)21(19)24)25-7-3-4-20(22)23/h5-6,8-12H,3-4,7H2,1-2H3,(H,22,23) |
| InChIKey | MDKSXCATNKHQJI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|