C26H18Cl2O5 — CID 3488155
[3-(4-ethylphenoxy)-4-oxochromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 3488155) has the molecular formula C26H18Cl2O5 and a molecular weight of 481.33 g/mol. Its IUPAC name is [3-(4-ethylphenoxy)-4-oxochromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [3-(4-ethylphenoxy)-4-oxochromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3488155 |
| Molecular Formula | C26H18Cl2O5 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | [3-(4-ethylphenoxy)-4-oxochromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | CCc1ccc(Oc2coc3cc(OC(=O)C=Cc4ccc(Cl)c(Cl)c4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H18Cl2O5/c1-2-16-3-7-18(8-4-16)32-24-15-31-23-14-19(9-10-20(23)26(24)30)33-25(29)12-6-17-5-11-21(27)22(28)13-17/h3-15H,2H2,1H3 |
| InChIKey | FXNJBWREGKWZLX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|