C29H26O8 — CID 2792994
[3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 2792994) has the molecular formula C29H26O8 and a molecular weight of 502.52 g/mol. Its IUPAC name is [3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | [3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2792994 |
| Molecular Formula | C29H26O8 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C=CC(=O)Oc2ccc3c(=O)c(Oc4ccc(OC)cc4)coc3c2)cc1OCC |
| InChI | InChI=1S/C29H26O8/c1-4-33-24-14-6-19(16-26(24)34-5-2)7-15-28(30)37-22-12-13-23-25(17-22)35-18-27(29(23)31)36-21-10-8-20(32-3)9-11-21/h6-18H,4-5H2,1-3H3 |
| InChIKey | CJRBTZHDPOHIQS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|