C32H23ClO7 — CID 4226667
[3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 4226667) has the molecular formula C32H23ClO7 and a molecular weight of 554.98 g/mol. Its IUPAC name is [3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4226667 |
| Molecular Formula | C32H23ClO7 |
| Molecular Weight | 554.98 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | [3-(4-methoxyphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COc1ccc(Oc2coc3cc(OC(=O)C=Cc4ccc(OCc5ccccc5Cl)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C32H23ClO7/c1-36-23-11-13-25(14-12-23)39-30-20-38-29-18-26(15-16-27(29)32(30)35)40-31(34)17-8-21-6-9-24(10-7-21)37-19-22-4-2-3-5-28(22)33/h2-18,20H,19H2,1H3 |
| InChIKey | IWPMAHGXXQYDAT-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.98 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|