C30H21ClO5 — CID 5227952
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-naphthalen-1-ylprop-2-enoate (PubChem CID 5227952) has the molecular formula C30H21ClO5 and a molecular weight of 496.95 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-naphthalen-1-ylprop-2-enoate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-naphthalen-1-ylprop-2-enoate |
|---|---|
| PubChem CID | 5227952 |
| Molecular Formula | C30H21ClO5 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-naphthalen-1-ylprop-2-enoate |
| SMILES | Cc1cc(Oc2coc3cc(OC(=O)C=Cc4cccc5ccccc45)ccc3c2=O)cc(C)c1Cl |
| InChI | InChI=1S/C30H21ClO5/c1-18-14-23(15-19(2)29(18)31)35-27-17-34-26-16-22(11-12-25(26)30(27)33)36-28(32)13-10-21-8-5-7-20-6-3-4-9-24(20)21/h3-17H,1-2H3 |
| InChIKey | LGDXIUNJOGXVGQ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|