C35H29ClO6 — CID 3342724
[3-(4-tert-butylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 3342724) has the molecular formula C35H29ClO6 and a molecular weight of 581.06 g/mol. Its IUPAC name is [3-(4-tert-butylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [3-(4-tert-butylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3342724 |
| Molecular Formula | C35H29ClO6 |
| Molecular Weight | 581.06 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [3-(4-tert-butylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)c1ccc(Oc2coc3cc(OC(=O)C=Cc4ccc(OCc5ccccc5Cl)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C35H29ClO6/c1-35(2,3)25-11-15-27(16-12-25)41-32-22-40-31-20-28(17-18-29(31)34(32)38)42-33(37)19-10-23-8-13-26(14-9-23)39-21-24-6-4-5-7-30(24)36/h4-20,22H,21H2,1-3H3 |
| InChIKey | GIAHASXIIJNBJL-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.06 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|