C33H25ClO6 — CID 5067900
[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 5067900) has the molecular formula C33H25ClO6 and a molecular weight of 553.01 g/mol. Its IUPAC name is [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5067900 |
| Molecular Formula | C33H25ClO6 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1cc(C)cc(Oc2coc3cc(OC(=O)C=Cc4ccc(OCc5ccccc5Cl)cc4)ccc3c2=O)c1 |
| InChI | InChI=1S/C33H25ClO6/c1-21-15-22(2)17-27(16-21)39-31-20-38-30-18-26(12-13-28(30)33(31)36)40-32(35)14-9-23-7-10-25(11-8-23)37-19-24-5-3-4-6-29(24)34/h3-18,20H,19H2,1-2H3 |
| InChIKey | QACYONHADZQARD-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|