C22H19ClO6 — CID 7082791
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate (PubChem CID 7082791) has the molecular formula C22H19ClO6 and a molecular weight of 414.84 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 7082791 |
| Molecular Formula | C22H19ClO6 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate |
| SMILES | Cc1cc(Oc2coc3cc(OC(=O)[C@H]4CCCO4)ccc3c2=O)cc(C)c1Cl |
| InChI | InChI=1S/C22H19ClO6/c1-12-8-15(9-13(2)20(12)23)28-19-11-27-18-10-14(5-6-16(18)21(19)24)29-22(25)17-4-3-7-26-17/h5-6,8-11,17H,3-4,7H2,1-2H3/t17-/m1/s1 |
| InChIKey | SEMNAPUJKOIMDM-QGZVFWFLSA-N |
| XLogP | 4.94 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|