C22H20O6 — CID 7082784
[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate (PubChem CID 7082784) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate.
| Compound Name | [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 7082784 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] (2R)-oxolane-2-carboxylate |
| SMILES | Cc1cc(C)cc(Oc2coc3cc(OC(=O)[C@H]4CCCO4)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H20O6/c1-13-8-14(2)10-16(9-13)27-20-12-26-19-11-15(5-6-17(19)21(20)23)28-22(24)18-4-3-7-25-18/h5-6,8-12,18H,3-4,7H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZVQFKRFTEHNSDD-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|