C27H23NO8 — CID 3769565
methyl 3-(4-hydroxyphenyl)-2-[[2-(4-oxo-3-phenoxychromen-7-yl)oxyacetyl]amino]propanoate (PubChem CID 3769565) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is methyl 3-(4-hydroxyphenyl)-2-[[2-(4-oxo-3-phenoxychromen-7-yl)oxyacetyl]amino]propanoate.
| Compound Name | methyl 3-(4-hydroxyphenyl)-2-[[2-(4-oxo-3-phenoxychromen-7-yl)oxyacetyl]amino]propanoate |
|---|---|
| PubChem CID | 3769565 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)-2-[[2-(4-oxo-3-phenoxychromen-7-yl)oxyacetyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)NC(=O)COc1ccc2c(=O)c(Oc3ccccc3)coc2c1 |
| InChI | InChI=1S/C27H23NO8/c1-33-27(32)22(13-17-7-9-18(29)10-8-17)28-25(30)16-34-20-11-12-21-23(14-20)35-15-24(26(21)31)36-19-5-3-2-4-6-19/h2-12,14-15,22,29H,13,16H2,1H3,(H,28,30) |
| InChIKey | CHUWLRDOGLGHOR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |