C27H25NO6 — CID 162959375
N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide (PubChem CID 162959375) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 162959375 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide |
| SMILES | COc1ccc(-c2coc3cc(OCC(=O)NC(CO)Cc4ccccc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C27H25NO6/c1-32-21-9-7-19(8-10-21)24-16-34-25-14-22(11-12-23(25)27(24)31)33-17-26(30)28-20(15-29)13-18-5-3-2-4-6-18/h2-12,14,16,20,29H,13,15,17H2,1H3,(H,28,30) |
| InChIKey | OZSMBUZKVRJVCE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |