C26H21NO6 — CID 164610853
N-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide (PubChem CID 164610853) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is N-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide.
| Compound Name | N-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 164610853 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxyacetamide |
| SMILES | COc1ccc(-c2coc3cc(OCC(=O)N/C=C\c4ccc(O)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H21NO6/c1-31-20-8-4-18(5-9-20)23-15-33-24-14-21(10-11-22(24)26(23)30)32-16-25(29)27-13-12-17-2-6-19(28)7-3-17/h2-15,28H,16H2,1H3,(H,27,29)/b13-12- |
| InChIKey | VAQNYFSLRWSRKL-SEYXRHQNSA-N |
| XLogP | 4.34 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |