C25H20O6 — CID 67279205
ethyl 4-[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate (PubChem CID 67279205) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is ethyl 4-[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate.
| Compound Name | ethyl 4-[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 67279205 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | ethyl 4-[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(COc2ccc3c(=O)c(-c4ccc(O)cc4)coc3c2)cc1 |
| InChI | InChI=1S/C25H20O6/c1-2-29-25(28)18-5-3-16(4-6-18)14-30-20-11-12-21-23(13-20)31-15-22(24(21)27)17-7-9-19(26)10-8-17/h3-13,15,26H,2,14H2,1H3 |
| InChIKey | HWZHNWHEZHACDC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |