C23H16N4O4 — CID 67279126
3-(4-hydroxyphenyl)-7-[[3-(5H-tetrazol-5-yl)phenyl]methoxy]chromen-4-one (PubChem CID 67279126) has the molecular formula C23H16N4O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-7-[[3-(5H-tetrazol-5-yl)phenyl]methoxy]chromen-4-one.
| Compound Name | 3-(4-hydroxyphenyl)-7-[[3-(5H-tetrazol-5-yl)phenyl]methoxy]chromen-4-one |
|---|---|
| PubChem CID | 67279126 |
| Molecular Formula | C23H16N4O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-(4-hydroxyphenyl)-7-[[3-(5H-tetrazol-5-yl)phenyl]methoxy]chromen-4-one |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(OCc3cccc(C4N=NN=N4)c3)ccc12 |
| InChI | InChI=1S/C23H16N4O4/c28-17-6-4-15(5-7-17)20-13-31-21-11-18(8-9-19(21)22(20)29)30-12-14-2-1-3-16(10-14)23-24-26-27-25-23/h1-11,13,23,28H,12H2 |
| InChIKey | KOYURRCJKKYZAM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |