C26H21NO7 — CID 42606143
methyl 3-[[3-[4-(2-amino-2-oxoethoxy)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoate (PubChem CID 42606143) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is methyl 3-[[3-[4-(2-amino-2-oxoethoxy)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoate.
| Compound Name | methyl 3-[[3-[4-(2-amino-2-oxoethoxy)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 42606143 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | methyl 3-[[3-[4-(2-amino-2-oxoethoxy)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2ccc3c(=O)c(-c4ccc(OCC(N)=O)cc4)coc3c2)c1 |
| InChI | InChI=1S/C26H21NO7/c1-31-26(30)18-4-2-3-16(11-18)13-32-20-9-10-21-23(12-20)34-14-22(25(21)29)17-5-7-19(8-6-17)33-15-24(27)28/h2-12,14H,13,15H2,1H3,(H2,27,28) |
| InChIKey | QMLJDJRQXXUTJD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |