C29H29NO6Si — CID 42606495
2-trimethylsilylethyl 3-[[3-(4-carbamoylphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate (PubChem CID 42606495) has the molecular formula C29H29NO6Si and a molecular weight of 515.64 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-[[3-(4-carbamoylphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate.
| Compound Name | 2-trimethylsilylethyl 3-[[3-(4-carbamoylphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 42606495 |
| Molecular Formula | C29H29NO6Si |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 2-trimethylsilylethyl 3-[[3-(4-carbamoylphenyl)-4-oxochromen-7-yl]oxymethyl]benzoate |
| SMILES | C[Si](C)(C)CCOC(=O)c1cccc(COc2ccc3c(=O)c(-c4ccc(C(N)=O)cc4)coc3c2)c1 |
| InChI | InChI=1S/C29H29NO6Si/c1-37(2,3)14-13-34-29(33)22-6-4-5-19(15-22)17-35-23-11-12-24-26(16-23)36-18-25(27(24)31)20-7-9-21(10-8-20)28(30)32/h4-12,15-16,18H,13-14,17H2,1-3H3,(H2,30,32) |
| InChIKey | LNLIHPSCCYLOHF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|