C22H13BrCl2O3 — CID 4627849
3-(4-bromophenyl)-7-[(3,4-dichlorophenyl)methoxy]chromen-4-one (PubChem CID 4627849) has the molecular formula C22H13BrCl2O3 and a molecular weight of 476.15 g/mol. Its IUPAC name is 3-(4-bromophenyl)-7-[(3,4-dichlorophenyl)methoxy]chromen-4-one.
| Compound Name | 3-(4-bromophenyl)-7-[(3,4-dichlorophenyl)methoxy]chromen-4-one |
|---|---|
| PubChem CID | 4627849 |
| Molecular Formula | C22H13BrCl2O3 |
| Molecular Weight | 476.15 g/mol |
| Exact Mass | 473.94 |
| IUPAC Name | 3-(4-bromophenyl)-7-[(3,4-dichlorophenyl)methoxy]chromen-4-one |
| SMILES | O=c1c(-c2ccc(Br)cc2)coc2cc(OCc3ccc(Cl)c(Cl)c3)ccc12 |
| InChI | InChI=1S/C22H13BrCl2O3/c23-15-4-2-14(3-5-15)18-12-28-21-10-16(6-7-17(21)22(18)26)27-11-13-1-8-19(24)20(25)9-13/h1-10,12H,11H2 |
| InChIKey | YBTLZSHYZDKTPG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.15 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |