C23H16Cl2O3 — CID 5025590
7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one (PubChem CID 5025590) has the molecular formula C23H16Cl2O3 and a molecular weight of 411.28 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one.
| Compound Name | 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 5025590 |
| Molecular Formula | C23H16Cl2O3 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one |
| SMILES | Cc1oc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H16Cl2O3/c1-14-22(16-5-3-2-4-6-16)23(26)18-9-8-17(12-21(18)28-14)27-13-15-7-10-19(24)20(25)11-15/h2-12H,13H2,1H3 |
| InChIKey | ZGLZTHDZZKMLGS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |