About 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one
7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one (PubChem CID 5025590) has the molecular formula C23H16Cl2O3
and a molecular weight of 411.28 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one.
Molecular Properties
| Compound Name | 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one |
| PubChem CID | 5025590 |
| Molecular Formula | C23H16Cl2O3 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one |
| SMILES | Cc1oc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H16Cl2O3/c1-14-22(16-5-3-2-4-6-16)23(26)18-9-8-17(12-21(18)28-14)27-13-15-7-10-19(24)20(25)11-15/h2-12H,13H2,1H3 |
| InChIKey | ZGLZTHDZZKMLGS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one?
The IUPAC name of 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one (CID 5025590) is 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one.
What is the SMILES notation for 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one?
The canonical SMILES for 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one is Cc1oc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2c(=O)c1-c1ccccc1.
What is the InChIKey of 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one?
The InChIKey is ZGLZTHDZZKMLGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16Cl2O3/c1-14-22(16-5-3-2-4-6-16)23(26)18-9-8-17(12-21(18)28-14)27-13-15-7-10-19(24)20(25)11-15/h2-12H,13H2,1H3.
What are the key properties of 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one?
7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one has a molecular weight of 411.28 g/mol, XLogP of 6.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,4-dichlorophenyl)methoxy]-2-methyl-3-phenylchromen-4-one is sourced from PubChem (CID 5025590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).