C22H14Cl2O3 — CID 2062848
7-[(3,4-dichlorophenyl)methoxy]-3-phenylchromen-2-one (PubChem CID 2062848) has the molecular formula C22H14Cl2O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methoxy]-3-phenylchromen-2-one.
| Compound Name | 7-[(3,4-dichlorophenyl)methoxy]-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 2062848 |
| Molecular Formula | C22H14Cl2O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methoxy]-3-phenylchromen-2-one |
| SMILES | O=c1oc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C22H14Cl2O3/c23-19-9-6-14(10-20(19)24)13-26-17-8-7-16-11-18(15-4-2-1-3-5-15)22(25)27-21(16)12-17/h1-12H,13H2 |
| InChIKey | IYCQOTKBXNJECV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|