C24H18ClFO5 — CID 2064308
7-[(2-chloro-6-fluorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)chromen-2-one (PubChem CID 2064308) has the molecular formula C24H18ClFO5 and a molecular weight of 440.85 g/mol. Its IUPAC name is 7-[(2-chloro-6-fluorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)chromen-2-one.
| Compound Name | 7-[(2-chloro-6-fluorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 2064308 |
| Molecular Formula | C24H18ClFO5 |
| Molecular Weight | 440.85 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 7-[(2-chloro-6-fluorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)chromen-2-one |
| SMILES | COc1ccc(-c2cc3ccc(OCc4c(F)cccc4Cl)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C24H18ClFO5/c1-28-21-9-7-14(11-23(21)29-2)17-10-15-6-8-16(12-22(15)31-24(17)27)30-13-18-19(25)4-3-5-20(18)26/h3-12H,13H2,1-2H3 |
| InChIKey | FDTANULBAFLYRD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.85 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|