C26H16F2O6 — CID 4967566
7-[(2,6-difluorophenyl)methoxy]-3-(7-methoxy-2-oxochromen-4-yl)chromen-2-one (PubChem CID 4967566) has the molecular formula C26H16F2O6 and a molecular weight of 462.40 g/mol. Its IUPAC name is 7-[(2,6-difluorophenyl)methoxy]-3-(7-methoxy-2-oxochromen-4-yl)chromen-2-one.
| Compound Name | 7-[(2,6-difluorophenyl)methoxy]-3-(7-methoxy-2-oxochromen-4-yl)chromen-2-one |
|---|---|
| PubChem CID | 4967566 |
| Molecular Formula | C26H16F2O6 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 7-[(2,6-difluorophenyl)methoxy]-3-(7-methoxy-2-oxochromen-4-yl)chromen-2-one |
| SMILES | COc1ccc2c(-c3cc4ccc(OCc5c(F)cccc5F)cc4oc3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H16F2O6/c1-31-15-7-8-17-18(12-25(29)33-24(17)10-15)19-9-14-5-6-16(11-23(14)34-26(19)30)32-13-20-21(27)3-2-4-22(20)28/h2-12H,13H2,1H3 |
| InChIKey | KBLRLMOXZAZJKB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|