C23H18O6 — CID 7198205
[2-oxo-4-(2-oxochromen-3-yl)chromen-7-yl] 2,2-dimethylpropanoate (PubChem CID 7198205) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is [2-oxo-4-(2-oxochromen-3-yl)chromen-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [2-oxo-4-(2-oxochromen-3-yl)chromen-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 7198205 |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [2-oxo-4-(2-oxochromen-3-yl)chromen-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(-c3cc4ccccc4oc3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H18O6/c1-23(2,3)22(26)27-14-8-9-15-16(12-20(24)28-19(15)11-14)17-10-13-6-4-5-7-18(13)29-21(17)25/h4-12H,1-3H3 |
| InChIKey | RPWBBNJXKNSLPS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|