C21H14ClNO6 — CID 7198182
[4-(6-chloro-2-oxochromen-3-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 7198182) has the molecular formula C21H14ClNO6 and a molecular weight of 411.80 g/mol. Its IUPAC name is [4-(6-chloro-2-oxochromen-3-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [4-(6-chloro-2-oxochromen-3-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 7198182 |
| Molecular Formula | C21H14ClNO6 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [4-(6-chloro-2-oxochromen-3-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2c(-c3cc4cc(Cl)ccc4oc3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H14ClNO6/c1-23(2)21(26)27-13-4-5-14-15(10-19(24)28-18(14)9-13)16-8-11-7-12(22)3-6-17(11)29-20(16)25/h3-10H,1-2H3 |
| InChIKey | RSYWTOKKDMRIGM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|