C19H19N3O4 — CID 59139378
[3-[(6-amino-2-pyridinyl)methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 59139378) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [3-[(6-amino-2-pyridinyl)methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[(6-amino-2-pyridinyl)methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 59139378 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [3-[(6-amino-2-pyridinyl)methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1c(Cc2cccc(N)n2)c(=O)oc2cc(OC(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C19H19N3O4/c1-11-14-8-7-13(25-19(24)22(2)3)10-16(14)26-18(23)15(11)9-12-5-4-6-17(20)21-12/h4-8,10H,9H2,1-3H3,(H2,20,21) |
| InChIKey | WBHSEIPUNHSUFK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|