C25H29FN4O4 — CID 171565931
[3-[(3-amino-2-fluorophenyl)methyl]-4-[[methyl(prop-2-ynyl)amino]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;methanamine (PubChem CID 171565931) has the molecular formula C25H29FN4O4 and a molecular weight of 468.53 g/mol. Its IUPAC name is [3-[(3-amino-2-fluorophenyl)methyl]-4-[[methyl(prop-2-ynyl)amino]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;methanamine.
| Compound Name | [3-[(3-amino-2-fluorophenyl)methyl]-4-[[methyl(prop-2-ynyl)amino]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;methanamine |
|---|---|
| PubChem CID | 171565931 |
| Molecular Formula | C25H29FN4O4 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | [3-[(3-amino-2-fluorophenyl)methyl]-4-[[methyl(prop-2-ynyl)amino]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;methanamine |
| SMILES | C#CCN(C)Cc1c(Cc2cccc(N)c2F)c(=O)oc2cc(OC(=O)N(C)C)ccc12.CN |
| InChI | InChI=1S/C24H24FN3O4.CH5N/c1-5-11-28(4)14-19-17-10-9-16(31-24(30)27(2)3)13-21(17)32-23(29)18(19)12-15-7-6-8-20(26)22(15)25;1-2/h1,6-10,13H,11-12,14,26H2,2-4H3;2H2,1H3 |
| InChIKey | LXVLIEJUXIAMHM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|