C23H27FN2O5 — CID 165147887
3-[(3-amino-2-fluorophenyl)methyl]-4-[(dimethylamino)methyl]-7-(2-methoxyethoxymethoxy)chromen-2-one (PubChem CID 165147887) has the molecular formula C23H27FN2O5 and a molecular weight of 430.48 g/mol. Its IUPAC name is 3-[(3-amino-2-fluorophenyl)methyl]-4-[(dimethylamino)methyl]-7-(2-methoxyethoxymethoxy)chromen-2-one.
| Compound Name | 3-[(3-amino-2-fluorophenyl)methyl]-4-[(dimethylamino)methyl]-7-(2-methoxyethoxymethoxy)chromen-2-one |
|---|---|
| PubChem CID | 165147887 |
| Molecular Formula | C23H27FN2O5 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-[(3-amino-2-fluorophenyl)methyl]-4-[(dimethylamino)methyl]-7-(2-methoxyethoxymethoxy)chromen-2-one |
| SMILES | COCCOCOc1ccc2c(CN(C)C)c(Cc3cccc(N)c3F)c(=O)oc2c1 |
| InChI | InChI=1S/C23H27FN2O5/c1-26(2)13-19-17-8-7-16(30-14-29-10-9-28-3)12-21(17)31-23(27)18(19)11-15-5-4-6-20(25)22(15)24/h4-8,12H,9-11,13-14,25H2,1-3H3 |
| InChIKey | RAZAIBYFSKXRQC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|