C17H13F2NO2 — CID 123939894
3-[(3-amino-2-fluorophenyl)methyl]-6-fluoro-4-methylchromen-2-one (PubChem CID 123939894) has the molecular formula C17H13F2NO2 and a molecular weight of 301.29 g/mol. Its IUPAC name is 3-[(3-amino-2-fluorophenyl)methyl]-6-fluoro-4-methylchromen-2-one.
| Compound Name | 3-[(3-amino-2-fluorophenyl)methyl]-6-fluoro-4-methylchromen-2-one |
|---|---|
| PubChem CID | 123939894 |
| Molecular Formula | C17H13F2NO2 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-[(3-amino-2-fluorophenyl)methyl]-6-fluoro-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2cccc(N)c2F)c(=O)oc2ccc(F)cc12 |
| InChI | InChI=1S/C17H13F2NO2/c1-9-12-8-11(18)5-6-15(12)22-17(21)13(9)7-10-3-2-4-14(20)16(10)19/h2-6,8H,7,20H2,1H3 |
| InChIKey | NENZQYMCRGDTGF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|