C34H26F2N2O8 — CID 158586516
3-[(3-amino-2-fluorophenyl)methyl]-7-hydroxy-4-methylchromen-2-one;3-[(2-fluoro-3-nitrophenyl)methyl]-7-hydroxy-4-methylchromen-2-one (PubChem CID 158586516) has the molecular formula C34H26F2N2O8 and a molecular weight of 628.58 g/mol. Its IUPAC name is 3-[(3-amino-2-fluorophenyl)methyl]-7-hydroxy-4-methylchromen-2-one;3-[(2-fluoro-3-nitrophenyl)methyl]-7-hydroxy-4-methylchromen-2-one.
| Compound Name | 3-[(3-amino-2-fluorophenyl)methyl]-7-hydroxy-4-methylchromen-2-one;3-[(2-fluoro-3-nitrophenyl)methyl]-7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 158586516 |
| Molecular Formula | C34H26F2N2O8 |
| Molecular Weight | 628.58 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | 3-[(3-amino-2-fluorophenyl)methyl]-7-hydroxy-4-methylchromen-2-one;3-[(2-fluoro-3-nitrophenyl)methyl]-7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2cccc(N)c2F)c(=O)oc2cc(O)ccc12.Cc1c(Cc2cccc([N+](=O)[O-])c2F)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C17H12FNO5.C17H14FNO3/c1-9-12-6-5-11(20)8-15(12)24-17(21)13(9)7-10-3-2-4-14(16(10)18)19(22)23;1-9-12-6-5-11(20)8-15(12)22-17(21)13(9)7-10-3-2-4-14(19)16(10)18/h2-6,8,20H,7H2,1H3;2-6,8,20H,7,19H2,1H3 |
| InChIKey | HTWVOLNGOWOGTN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 170.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|