C24H31N4O3Y- — CID 168982928
3-[(3-amino-2-methylphenyl)methyl]-7-hydroxy-4-(piperazin-1-ylmethyl)chromen-2-one;dimethylazanide;yttrium (PubChem CID 168982928) has the molecular formula C24H31N4O3Y- and a molecular weight of 512.44 g/mol. Its IUPAC name is 3-[(3-amino-2-methylphenyl)methyl]-7-hydroxy-4-(piperazin-1-ylmethyl)chromen-2-one;dimethylazanide;yttrium.
| Compound Name | 3-[(3-amino-2-methylphenyl)methyl]-7-hydroxy-4-(piperazin-1-ylmethyl)chromen-2-one;dimethylazanide;yttrium |
|---|---|
| PubChem CID | 168982928 |
| Molecular Formula | C24H31N4O3Y- |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 3-[(3-amino-2-methylphenyl)methyl]-7-hydroxy-4-(piperazin-1-ylmethyl)chromen-2-one;dimethylazanide;yttrium |
| SMILES | C[N-]C.Cc1c(N)cccc1Cc1c(CN2CCNCC2)c2ccc(O)cc2oc1=O.[Y] |
| InChI | InChI=1S/C22H25N3O3.C2H6N.Y/c1-14-15(3-2-4-20(14)23)11-18-19(13-25-9-7-24-8-10-25)17-6-5-16(26)12-21(17)28-22(18)27;1-3-2;/h2-6,12,24,26H,7-11,13,23H2,1H3;1-2H3;/q;-1; |
| InChIKey | QFJCZCFZOQRROY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|