C19H19BrN2O3 — CID 168982880
3-[(3-amino-2-bromophenyl)methyl]-4-[(dimethylamino)methyl]-7-hydroxychromen-2-one (PubChem CID 168982880) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is 3-[(3-amino-2-bromophenyl)methyl]-4-[(dimethylamino)methyl]-7-hydroxychromen-2-one.
| Compound Name | 3-[(3-amino-2-bromophenyl)methyl]-4-[(dimethylamino)methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 168982880 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 3-[(3-amino-2-bromophenyl)methyl]-4-[(dimethylamino)methyl]-7-hydroxychromen-2-one |
| SMILES | CN(C)Cc1c(Cc2cccc(N)c2Br)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C19H19BrN2O3/c1-22(2)10-15-13-7-6-12(23)9-17(13)25-19(24)14(15)8-11-4-3-5-16(21)18(11)20/h3-7,9,23H,8,10,21H2,1-2H3 |
| InChIKey | FDQWMIUMCRVNNB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|