C23H24ClFN2O4 — CID 168982897
[3-[[3-(chloromethyl)-2-fluorophenyl]methyl]-4-[(dimethylamino)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 168982897) has the molecular formula C23H24ClFN2O4 and a molecular weight of 446.91 g/mol. Its IUPAC name is [3-[[3-(chloromethyl)-2-fluorophenyl]methyl]-4-[(dimethylamino)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[[3-(chloromethyl)-2-fluorophenyl]methyl]-4-[(dimethylamino)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 168982897 |
| Molecular Formula | C23H24ClFN2O4 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [3-[[3-(chloromethyl)-2-fluorophenyl]methyl]-4-[(dimethylamino)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)Cc1c(Cc2cccc(CCl)c2F)c(=O)oc2cc(OC(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C23H24ClFN2O4/c1-26(2)13-19-17-9-8-16(30-23(29)27(3)4)11-20(17)31-22(28)18(19)10-14-6-5-7-15(12-24)21(14)25/h5-9,11H,10,12-13H2,1-4H3 |
| InChIKey | YLRFVAYHKKMKQK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|