C23H26FN3O7S — CID 168982937
4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-(sulfinoamino)phenyl]methyl]-5-methoxy-2-oxochromene (PubChem CID 168982937) has the molecular formula C23H26FN3O7S and a molecular weight of 507.54 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-(sulfinoamino)phenyl]methyl]-5-methoxy-2-oxochromene.
| Compound Name | 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-(sulfinoamino)phenyl]methyl]-5-methoxy-2-oxochromene |
|---|---|
| PubChem CID | 168982937 |
| Molecular Formula | C23H26FN3O7S |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-(sulfinoamino)phenyl]methyl]-5-methoxy-2-oxochromene |
| SMILES | COc1cc(OC(=O)N(C)C)cc2oc(=O)c(Cc3cccc(NS(=O)O)c3F)c(CN(C)C)c12 |
| InChI | InChI=1S/C23H26FN3O7S/c1-26(2)12-16-15(9-13-7-6-8-17(21(13)24)25-35(30)31)22(28)34-19-11-14(33-23(29)27(3)4)10-18(32-5)20(16)19/h6-8,10-11,25H,9,12H2,1-5H3,(H,30,31) |
| InChIKey | IJYRLTJDMDGBPA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|