C23H26FN3O6S — CID 168982830
4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-[methyl(sulfino)amino]phenyl]methyl]-2-oxochromene (PubChem CID 168982830) has the molecular formula C23H26FN3O6S and a molecular weight of 491.54 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-[methyl(sulfino)amino]phenyl]methyl]-2-oxochromene.
| Compound Name | 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-[methyl(sulfino)amino]phenyl]methyl]-2-oxochromene |
|---|---|
| PubChem CID | 168982830 |
| Molecular Formula | C23H26FN3O6S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-3-[[2-fluoro-3-[methyl(sulfino)amino]phenyl]methyl]-2-oxochromene |
| SMILES | CN(C)Cc1c(Cc2cccc(N(C)S(=O)O)c2F)c(=O)oc2cc(OC(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C23H26FN3O6S/c1-25(2)13-18-16-10-9-15(32-23(29)26(3)4)12-20(16)33-22(28)17(18)11-14-7-6-8-19(21(14)24)27(5)34(30)31/h6-10,12H,11,13H2,1-5H3,(H,30,31) |
| InChIKey | XFEGJSWKHSECKR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|