C22H22F2N3O6S- — CID 168982971
4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-5-fluoro-3-[[2-fluoro-3-(sulfinatoamino)phenyl]methyl]-2-oxochromene (PubChem CID 168982971) has the molecular formula C22H22F2N3O6S- and a molecular weight of 494.50 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-5-fluoro-3-[[2-fluoro-3-(sulfinatoamino)phenyl]methyl]-2-oxochromene.
| Compound Name | 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-5-fluoro-3-[[2-fluoro-3-(sulfinatoamino)phenyl]methyl]-2-oxochromene |
|---|---|
| PubChem CID | 168982971 |
| Molecular Formula | C22H22F2N3O6S- |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 4-[(dimethylamino)methyl]-7-(dimethylcarbamoyloxy)-5-fluoro-3-[[2-fluoro-3-(sulfinatoamino)phenyl]methyl]-2-oxochromene |
| SMILES | CN(C)Cc1c(Cc2cccc(NS(=O)[O-])c2F)c(=O)oc2cc(OC(=O)N(C)C)cc(F)c12 |
| InChI | InChI=1S/C22H23F2N3O6S/c1-26(2)11-15-14(8-12-6-5-7-17(20(12)24)25-34(30)31)21(28)33-18-10-13(9-16(23)19(15)18)32-22(29)27(3)4/h5-7,9-10,25H,8,11H2,1-4H3,(H,30,31)/p-1 |
| InChIKey | DILXDSXGHKYTMD-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|