C14H14N2O4 — CID 27215307
4-[(7-hydroxy-2-oxochromen-4-yl)methyl]piperazin-2-one (PubChem CID 27215307) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-[(7-hydroxy-2-oxochromen-4-yl)methyl]piperazin-2-one.
| Compound Name | 4-[(7-hydroxy-2-oxochromen-4-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 27215307 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-[(7-hydroxy-2-oxochromen-4-yl)methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cc(=O)oc3cc(O)ccc23)CCN1 |
| InChI | InChI=1S/C14H14N2O4/c17-10-1-2-11-9(5-14(19)20-12(11)6-10)7-16-4-3-15-13(18)8-16/h1-2,5-6,17H,3-4,7-8H2,(H,15,18) |
| InChIKey | ODAPSZPYLJCVCA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|