C17H19F2NO3 — CID 139020957
4-[(4,4-difluoro-3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxychromen-2-one (PubChem CID 139020957) has the molecular formula C17H19F2NO3 and a molecular weight of 323.34 g/mol. Its IUPAC name is 4-[(4,4-difluoro-3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[(4,4-difluoro-3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 139020957 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-[(4,4-difluoro-3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxychromen-2-one |
| SMILES | CC1CN(Cc2cc(=O)oc3cc(O)ccc23)CC(C)C1(F)F |
| InChI | InChI=1S/C17H19F2NO3/c1-10-7-20(8-11(2)17(10,18)19)9-12-5-16(22)23-15-6-13(21)3-4-14(12)15/h3-6,10-11,21H,7-9H2,1-2H3 |
| InChIKey | JDLGEWJRLUIYEY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|