C22H21NO4 — CID 138992779
7-hydroxy-4-(spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylmethyl)chromen-2-one (PubChem CID 138992779) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 7-hydroxy-4-(spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylmethyl)chromen-2-one.
| Compound Name | 7-hydroxy-4-(spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 138992779 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 7-hydroxy-4-(spiro[1,2-dihydroindene-3,2'-morpholine]-4'-ylmethyl)chromen-2-one |
| SMILES | O=c1cc(CN2CCOC3(CCc4ccccc43)C2)c2ccc(O)cc2o1 |
| InChI | InChI=1S/C22H21NO4/c24-17-5-6-18-16(11-21(25)27-20(18)12-17)13-23-9-10-26-22(14-23)8-7-15-3-1-2-4-19(15)22/h1-6,11-12,24H,7-10,13-14H2 |
| InChIKey | IYWFAHNVSNGGQD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|