C20H19NO3S — CID 9002494
4-[[(4R)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-7-hydroxychromen-2-one (PubChem CID 9002494) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[(4R)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[(4R)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 9002494 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[[(4R)-4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-7-hydroxychromen-2-one |
| SMILES | O=c1cc(CN2CCc3sccc3[C@H]2C2CC2)c2ccc(O)cc2o1 |
| InChI | InChI=1S/C20H19NO3S/c22-14-3-4-15-13(9-19(23)24-17(15)10-14)11-21-7-5-18-16(6-8-25-18)20(21)12-1-2-12/h3-4,6,8-10,12,20,22H,1-2,5,7,11H2/t20-/m1/s1 |
| InChIKey | SJKLXBHQHIMRSH-HXUWFJFHSA-N |
| XLogP | 4.07 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|