C21H23NO2S — CID 8999601
4-[[(4S)-4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7-dimethylchromen-2-one (PubChem CID 8999601) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[[(4S)-4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[(4S)-4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 8999601 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[[(4S)-4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methyl]-6,7-dimethylchromen-2-one |
| SMILES | CC[C@H]1c2ccsc2CCN1Cc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C21H23NO2S/c1-4-18-16-6-8-25-20(16)5-7-22(18)12-15-11-21(23)24-19-10-14(3)13(2)9-17(15)19/h6,8-11,18H,4-5,7,12H2,1-3H3/t18-/m0/s1 |
| InChIKey | CVMZMVNLTCTHKO-SFHVURJKSA-N |
| XLogP | 4.98 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|