C22H23NO2 — CID 71881985
6,7-dimethyl-4-[(3-phenylpyrrolidin-1-yl)methyl]chromen-2-one (PubChem CID 71881985) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 6,7-dimethyl-4-[(3-phenylpyrrolidin-1-yl)methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[(3-phenylpyrrolidin-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 71881985 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6,7-dimethyl-4-[(3-phenylpyrrolidin-1-yl)methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCC(c4ccccc4)C3)c2cc1C |
| InChI | InChI=1S/C22H23NO2/c1-15-10-20-19(12-22(24)25-21(20)11-16(15)2)14-23-9-8-18(13-23)17-6-4-3-5-7-17/h3-7,10-12,18H,8-9,13-14H2,1-2H3 |
| InChIKey | AQZOIWPKADJPLD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|