C23H24N4O2 — CID 50969547
6,7-dimethyl-4-[[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]chromen-2-one (PubChem CID 50969547) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 50969547 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 6,7-dimethyl-4-[[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCCC(c4nnc5ccccn45)C3)c2cc1C |
| InChI | InChI=1S/C23H24N4O2/c1-15-10-19-18(12-22(28)29-20(19)11-16(15)2)14-26-8-5-6-17(13-26)23-25-24-21-7-3-4-9-27(21)23/h3-4,7,9-12,17H,5-6,8,13-14H2,1-2H3 |
| InChIKey | GCAKBWALFBEIAN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|