C20H26N2O4S — CID 31136077
4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one (PubChem CID 31136077) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 31136077 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN([C@@H]4CCS(=O)(=O)C4)CC3)c2cc1C |
| InChI | InChI=1S/C20H26N2O4S/c1-14-9-18-16(11-20(23)26-19(18)10-15(14)2)12-21-4-6-22(7-5-21)17-3-8-27(24,25)13-17/h9-11,17H,3-8,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | FEYQPRKVDLBRCH-QGZVFWFLSA-N |
| XLogP | 1.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|