C16H24N2O2S — CID 42916794
3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]thiolane 1,1-dioxide (PubChem CID 42916794) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 42916794 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]thiolane 1,1-dioxide |
| SMILES | Cc1cccc(CN2CCN(C3CCS(=O)(=O)C3)CC2)c1 |
| InChI | InChI=1S/C16H24N2O2S/c1-14-3-2-4-15(11-14)12-17-6-8-18(9-7-17)16-5-10-21(19,20)13-16/h2-4,11,16H,5-10,12-13H2,1H3 |
| InChIKey | ANQPPUCIBNJWQB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |