C24H23NO6 — CID 8526949
(7-hydroxy-2-oxochromen-4-yl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 8526949) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8526949 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CC(=O)N1CCC(C(=O)OCc2cc(=O)oc3cc(O)ccc23)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23NO6/c1-16(26)25-11-9-24(10-12-25,18-5-3-2-4-6-18)23(29)30-15-17-13-22(28)31-21-14-19(27)7-8-20(17)21/h2-8,13-14,27H,9-12,15H2,1H3 |
| InChIKey | NMTUWJULOCCPJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|