C20H19NO4 — CID 45483647
N,N-dimethyl-2-(2-oxo-7-phenylmethoxychromen-4-yl)acetamide (PubChem CID 45483647) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-oxo-7-phenylmethoxychromen-4-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(2-oxo-7-phenylmethoxychromen-4-yl)acetamide |
|---|---|
| PubChem CID | 45483647 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N,N-dimethyl-2-(2-oxo-7-phenylmethoxychromen-4-yl)acetamide |
| SMILES | CN(C)C(=O)Cc1cc(=O)oc2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C20H19NO4/c1-21(2)19(22)10-15-11-20(23)25-18-12-16(8-9-17(15)18)24-13-14-6-4-3-5-7-14/h3-9,11-12H,10,13H2,1-2H3 |
| InChIKey | ROAIVCUOJBAAAE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|